id | C00003072 |
---|---|
Name | Asperuloside |
CAS RN | 14259-45-1 |
Standard InChI | InChI=1S/C18H22O11/c1-6(20)25-4-7-2-9-12-8(16(24)27-9)5-26-17(11(7)12)29-18-15(23)14(22)13(21)10(3-19)28-18/h2,5,9-15,17-19,21-23H,3-4H2,1H3/t9-,10?,11+,12-,13+,14-,15?,17-,18-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C18H22O11/c1-6(20)25-4-7-2-9-12-8(16(24)27-9)5-26-17(11(7)12)29-18-15(23)14(22)13(21)10(3-19)28-18/h2,5,9-15,17-19,21-23H,3-4H2,1H3 |
Phytochemical cluster | No. 36 |
---|---|
KCF-S cluster | No. 100 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL461910 CHEMBL1965021 |
By LinkDB | C09769 |
---|
By CAS RN | C077956 |
---|
class name | count |
---|---|
asterids | 30 |
eudicotyledons | 2 |
family name | count |
---|---|
Rubiaceae | 18 |
Plantaginaceae | 10 |
Daphniphyllaceae | 2 |
Asteraceae | 1 |
Escalloniaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL461910 |
CHEMBL1794401
(1)
|
0 / 0 |