| id | C00004028 |
|---|---|
| Name | Mulberrin / Kuwanon C / Norartocarpin / 2-(2,4-Dihydroxyphenyl)-5,7-dihydroxy-3,8-bis(3-methyl-2-butenyl)-4H-1-benzopyran-4-one |
| CAS RN | 62949-79-5 |
| Standard InChI | InChI=1S/C25H26O6/c1-13(2)5-8-17-20(28)12-21(29)22-23(30)18(9-6-14(3)4)24(31-25(17)22)16-10-7-15(26)11-19(16)27/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C25H26O6/c1-13(2)5-8-17-20(28)12-21(29)22-23(30)18(9-6-14(3)4)24(31-25(17)22)16-10-7-15(26)11-19(16)27/h5-7,10-12,26-29H,8-9H2,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL518543 |
|---|---|
| By standard InChI Main Layer | CHEMBL518543 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artocarpus fretessi | 3488 | Moraceae | rosids | Viridiplantae |
| Artocarpus gomezianus Wallich ex Trecul | 3488 | Moraceae | rosids | Viridiplantae |
| Artocarpus heterophyllus | 3489 | Moraceae | rosids | Viridiplantae |
| Morus alba | 3498 | Moraceae | rosids | Viridiplantae |
| Morus australis | 66392 | Moraceae | rosids | Viridiplantae |
| Morus mongolica | 229049 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL518543 |
CHEMBL1008495
(1)
|
0 / 3 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL518543 |
CHEMBL1008496
(1)
|
0 / 0 |
| P56817 | Beta-secretase 1 | A1A | CHEMBL518543 |
CHEMBL1771831
(1)
CHEMBL1771832
(1)
|
0 / 0 |