id | C00004684 |
---|---|
Name | Axillarin / Quercetagetin 3,6-dimethyl ether / 3,6-Dimethoxy-5,7,3',4'-tetrahydroxyflavone / 2-(3,4-Dihydroxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one |
CAS RN | 5188-73-8 |
Standard InChI | InChI=1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C17H14O8/c1-23-16-10(20)6-11-12(13(16)21)14(22)17(24-2)15(25-11)7-3-4-8(18)9(19)5-7/h3-6,18-21H,1-2H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 3 |
By standard InChI | CHEMBL487810 |
---|---|
By standard InChI Main Layer | CHEMBL487810 |
By LinkDB | C10021 |
---|
By CAS RN | C056669 |
---|
class name | count |
---|---|
asterids | 30 |
rosids | 3 |
eudicotyledons | 1 |
family name | count |
---|---|
Asteraceae | 30 |
Didiereaceae | 1 |
Rutaceae | 1 |
Cistaceae | 1 |
Cleomaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL487810 |
CHEMBL973963
(1)
|
1 / 1 |