id | C00005525 |
---|---|
Name | Isorhamnetin 3-glucoside / Isorhamnetin 3-O-glucoside / Isorhamnetin 3-O-beta-D-glucoside / Isorhamnetin 3-O-beta-D-glucopyranoside |
CAS RN | 5041-82-7 |
Standard InChI | InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)25)20-21(17(28)15-11(26)5-9(24)6-13(15)32-20)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3/t14-,16-,18?,19?,22+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)25)20-21(17(28)15-11(26)5-9(24)6-13(15)32-20)34-22-19(30)18(29)16(27)14(7-23)33-22/h2-6,14,16,18-19,22-27,29-30H,7H2,1H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 2 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL234316 CHEMBL516621 |
By LinkDB |
---|
By CAS RN |
---|
class name | count |
---|---|
asterids | 12 |
rosids | 12 |
eudicotyledons | 7 |
Liliopsida | 4 |
Magnoliophyta | 3 |
Spermatophyta | 2 |
family name | count |
---|---|
Asteraceae | 8 |
Fabaceae | 4 |
Zygophyllaceae | 3 |
Apiaceae | 2 |
Saxifragaceae | 2 |
Pinaceae | 2 |
Cactaceae | 2 |
Annonaceae | 2 |
Crassulaceae | 1 |
Myrtaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL516621 |
CHEMBL993916
(1)
|
1 / 0 |