| id | C00006229 |
|---|---|
| Name | Vicenin 2 / Apigenin 6,8-di-C-glucoside |
| CAS RN | 23666-13-9 |
| Standard InChI | InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2/t12?,13?,17-,18-,21+,22+,23?,24?,26+,27+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O15/c28-6-12-17(32)21(36)23(38)26(41-12)15-19(34)14-10(31)5-11(8-1-3-9(30)4-2-8)40-25(14)16(20(15)35)27-24(39)22(37)18(33)13(7-29)42-27/h1-5,12-13,17-18,21-24,26-30,32-39H,6-7H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1442950 |
| By LinkDB | C10195 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 15 |
| rosids | 7 |
| Liliopsida | 2 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Lamiaceae | 10 |
| Asteraceae | 4 |
| Fabaceae | 3 |
| Violaceae | 2 |
| Poaceae | 1 |
| Cyperaceae | 1 |
| Cucurbitaceae | 1 |
| Plantaginaceae | 1 |
| Caryophyllaceae | 1 |
| Rutaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P04062 | Glucosylceramidase | Enzyme | CHEMBL1442950 |
CHEMBL1613818
(1)
|
6 / 4 |
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL1442950 |
CHEMBL1614103
(1)
CHEMBL1614031
(1)
|
1 / 1 |
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL1442950 |
CHEMBL2114810
(1)
|
7 / 3 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL1442950 |
CHEMBL1614211
(1)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL1442950 |
CHEMBL1613914
(1)
|
0 / 0 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL1442950 |
CHEMBL1738442
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah |
P63092
|
| #608013 | Gaucher disease, perinatal lethal |
P04062
|
| #230800 | Gaucher disease, type i |
P04062
|
| #230900 | Gaucher disease, type ii |
P04062
|
| #231000 | Gaucher disease, type iii |
P04062
|
| #231005 | Gaucher disease, type iiic |
P04062
|
| #232300 | Glycogen storage disease ii |
P10253
|
| #174800 | Mccune-albright syndrome; mas |
P63092
|
| #166350 | Osseous heteroplasia, progressive; poh |
P63092
|
| #168600 | Parkinson disease, late-onset; pd |
P04062
|
| #102200 | Pituitary adenoma, growth hormone-secreting |
P63092
|
| #103580 | Pseudohypoparathyroidism, type ia; php1a |
P63092
|
| #603233 | Pseudohypoparathyroidism, type ib; php1b |
P63092
|
| #612462 | Pseudohypoparathyroidism, type ic; php1c |
P63092
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00066 | Lewy body dementia (LBD) |
P04062
(related)
|
| H00126 | Gaucher disease |
P04062
(related)
|
| H00426 | Defects in the degradation of ganglioside |
P04062
(related)
|
| H00810 | Progressive myoclonic epilepsy (PME) |
P04062
(related)
|
| H00069 | Glycogen storage diseases (GSD) |
P10253
(related)
|
| H00244 | Pseudohypoparathyroidism |
P63092
(related)
|
| H00441 | Progressive osseous heteroplasia (POH) |
P63092
(related)
|
| H00501 | Fibrous dysplasia, polyostotic |
P63092
(related)
|