| id | C00004653 |
|---|---|
| Name | Retusine / Retusin(Ariocarpus) / Quercetin 3,7,3',4'-tetramethyl ether / 5-Hydroxy-3,7,3',4'-tetramethoxyflavone / 2-(3,4-Dimethoxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
| CAS RN | 1245-15-4 |
| Standard InChI | InChI=1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C19H18O7/c1-22-11-8-12(20)16-15(9-11)26-18(19(25-4)17(16)21)10-5-6-13(23-2)14(7-10)24-3/h5-9,20H,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL77966 |
|---|---|
| By standard InChI Main Layer | CHEMBL77966 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 11 |
| asterids | 11 |
| eudicotyledons | 3 |
| Liliopsida | 3 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 9 |
| Zingiberaceae | 2 |
| Rutaceae | 2 |
| Cunoniaceae | 2 |
| Orchidaceae | 1 |
| Solanaceae | 1 |
| Pteromalidae | 1 |
| Nyctaginaceae | 1 |
| Boraginaceae | 1 |
| Cactaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P33527 | Multidrug resistance-associated protein 1 | drugs | CHEMBL77966 |
CHEMBL1687517
(1)
CHEMBL2045961
(1)
|
0 / 0 |
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL77966 |
CHEMBL1687396
(1)
|
1 / 0 |
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL77966 |
CHEMBL1687393
(1)
CHEMBL1687394
(1)
CHEMBL2045959 (1) CHEMBL2045960 (1) |
2 / 0 |