id | C00007234 |
---|---|
Name | Katuranin / (+)-Aromadendrin / (+)-Dihydrokaempferol / (2R,3R)-2,3-Dihydro-3,5,7-trihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one |
CAS RN | 480-20-6 |
Standard InChI | InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H/t14-,15+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C15H12O6/c16-8-3-1-7(2-4-8)15-14(20)13(19)12-10(18)5-9(17)6-11(12)21-15/h1-6,14-18,20H |
Phytochemical cluster | No. 14 |
---|---|
KCF-S cluster | No. 42 |
By standard InChI | CHEMBL9323 |
---|---|
By standard InChI Main Layer | CHEMBL9323 CHEMBL1933859 |
By LinkDB | C00974 |
---|
By CAS RN | C080220 |
---|
class name | count |
---|---|
rosids | 23 |
asterids | 4 |
Spermatophyta | 4 |
eudicotyledons | 2 |
family name | count |
---|---|
Fabaceae | 4 |
Myrtaceae | 4 |
Rhamnaceae | 3 |
Moraceae | 2 |
Brassicaceae | 2 |
Rutaceae | 2 |
Ericaceae | 1 |
Geraniaceae | 1 |
Cephalotaxaceae | 1 |
Cupressaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P36888 | Receptor-type tyrosine-protein kinase FLT3 | Pdgfr | CHEMBL9323 |
CHEMBL2342404
(1)
|
1 / 1 |
O75496 | Geminin | Unclassified protein | CHEMBL9323 |
CHEMBL2114843
(1)
|
0 / 0 |
P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL9323 |
CHEMBL1794401
(1)
|
0 / 0 |
P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL9323 |
CHEMBL949646
(1)
|
2 / 2 |