| id | C00009516 |
|---|---|
| Name | 6,8-Diprenylgenistein / 8-(gamma,gamma-Dimethylallyl)wighteone / 5,7,4'-Trihydroxy-6,8-diprenylisoflavone |
| CAS RN | 51225-28-6 |
| Standard InChI | InChI=1S/C25H26O5/c1-14(2)5-11-18-22(27)19(12-6-15(3)4)25-21(23(18)28)24(29)20(13-30-25)16-7-9-17(26)10-8-16/h5-10,13,26-28H,11-12H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C25H26O5/c1-14(2)5-11-18-22(27)19(12-6-15(3)4)25-21(23(18)28)24(29)20(13-30-25)16-7-9-17(26)10-8-16/h5-10,13,26-28H,11-12H2,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL494252 |
|---|---|
| By standard InChI Main Layer | CHEMBL494252 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL494252 |
CHEMBL2114784
(1)
|
1 / 1 |
| P04062 | Glucosylceramidase | Enzyme | CHEMBL494252 |
CHEMBL1613818
(1)
|
6 / 4 |
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL494252 |
CHEMBL1794584
(1)
|
2 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL494252 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL494252 |
CHEMBL2114788
(1)
|
0 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL494252 |
CHEMBL1614521
(1)
|
0 / 0 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL494252 |
CHEMBL1738588
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL494252 |
CHEMBL1737991
(1)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL494252 |
CHEMBL1614250
(1)
CHEMBL1614421
(1)
CHEMBL1614502 (1) |
4 / 3 |
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL494252 |
CHEMBL1738184
(1)
|
0 / 0 |
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL494252 |
CHEMBL2354311
(1)
|
1 / 0 |
| P01215 | Glycoprotein hormones alpha chain | Unclassified protein | CHEMBL494252 |
CHEMBL2114913
(1)
|
0 / 3 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #114500 | Colorectal cancer; crc |
P84022
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #608013 | Gaucher disease, perinatal lethal |
P04062
|
| #230800 | Gaucher disease, type i |
P04062
|
| #230900 | Gaucher disease, type ii |
P04062
|
| #231000 | Gaucher disease, type iii |
P04062
|
| #231005 | Gaucher disease, type iiic |
P04062
|
| #137800 | Glioma susceptibility 1; glm1 |
O75874
|
| #613795 | Loeys-dietz syndrome, type 3; lds3 |
P84022
|
| #168600 | Parkinson disease, late-onset; pd |
P04062
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #183090 | Spinocerebellar ataxia 2; sca2 |
Q99700
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00081 | Hashimoto's thyroiditis |
P01215
(marker)
|
| H00082 | Graves' disease |
P01215
(marker)
|
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) |
P01215
(marker)
|
| H00066 | Lewy body dementia (LBD) |
P04062
(related)
|
| H00126 | Gaucher disease |
P04062
(related)
|
| H00426 | Defects in the degradation of ganglioside |
P04062
(related)
|
| H00810 | Progressive myoclonic epilepsy (PME) |
P04062
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00063 | Spinocerebellar ataxia (SCA) |
Q99700
(related)
|