| id | C00001016 |
|---|---|
| Name | 7-O-Methylacacetin / Acacetin 7-methyl ether / Genkwanin 4'-methyl ether / Apigenin 7,4'-dimethyl ether / 5-Hydroxy-4',7-dimethoxyflavone / 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| CAS RN | 5128-44-9 |
| Standard InChI | InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-9,18H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O5/c1-20-11-5-3-10(4-6-11)15-9-14(19)17-13(18)7-12(21-2)8-16(17)22-15/h3-9,18H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL350958 |
|---|---|
| By standard InChI Main Layer | CHEMBL350958 |
| By LinkDB | C10019 |
|---|
| By CAS RN | C044998 |
|---|
| class name | count |
|---|---|
| asterids | 44 |
| rosids | 7 |
| Magnoliophyta | 4 |
| Embryophyta | 3 |
| eudicotyledons | 1 |
| Euphyllophyta | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Lamiaceae | 31 |
| Asteraceae | 7 |
| Piperaceae | 3 |
| Betulaceae | 2 |
| Plantaginaceae | 2 |
| Lejeuneaceae | 2 |
| Cistaceae | 2 |
| Orobanchaceae | 1 |
| Passifloraceae | 1 |
| Nyctaginaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL350958 |
CHEMBL643650
(1)
|
0 / 0 |