| id | C00025334 |
|---|---|
| Name | trans-Feruloyltyramine / N-trans-Feruloyltyramine / trans-N-Feruloyltyramine |
| CAS RN | 66648-43-9 |
| Standard InChI | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+ |
| Standard InChI (Main Layer) | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 499 |
| By standard InChI | CHEMBL206555 |
|---|---|
| By standard InChI Main Layer | CHEMBL206555 CHEMBL451720 |
| By LinkDB | C02717 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 12 |
| eudicotyledons | 8 |
| asterids | 3 |
| rosids | 2 |
| family name | count |
|---|---|
| Menispermaceae | 4 |
| Piperaceae | 3 |
| Solanaceae | 3 |
| Aristolochiaceae | 3 |
| Annonaceae | 2 |
| Monimiaceae | 2 |
| Lauraceae | 2 |
| Amaranthaceae | 1 |
| Plumbaginaceae | 1 |
| Zygophyllaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL206555 |
CHEMBL870666
(1)
|
4 / 2 |