| id | C00031258 |
|---|---|
| Name | Sabinene / 4(10)-Thujene |
| CAS RN | 3387-41-5 |
| Standard InChI | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C10H16/c1-7(2)10-5-4-8(3)9(10)6-10/h7,9H,3-6H2,1-2H3 |
| Phytochemical cluster | No. 35 |
|---|---|
| KCF-S cluster | No. 1343 |
| By standard InChI | CHEMBL452687 |
|---|---|
| By standard InChI Main Layer | CHEMBL452687 |
| By LinkDB | C16777 |
|---|
| By CAS RN | C035127 |
|---|
| class name | count |
|---|---|
| rosids | 13 |
| asterids | 11 |
| Liliopsida | 6 |
| Spermatophyta | 2 |
| Magnoliophyta | 2 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Rutaceae | 8 |
| Zingiberaceae | 5 |
| Asteraceae | 4 |
| Solanaceae | 4 |
| Pinaceae | 2 |
| Lamiaceae | 2 |
| Piperaceae | 2 |
| Brassicaceae | 1 |
| Acoraceae | 1 |
| Cistaceae | 1 |