| id | C00004573 |
|---|---|
| Name | 3,7,4'-Tri-O-methylkaempferol / Kaempferol 3,7,4'-trimethyl ether / 5-Hydroxy-3,7,4'-trimethoxyflavone / 5-Hydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one |
| CAS RN | 15486-34-7 |
| Standard InChI | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)17-18(23-3)16(20)15-13(19)8-12(22-2)9-14(15)24-17/h4-9,19H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)17-18(23-3)16(20)15-13(19)8-12(22-2)9-14(15)24-17/h4-9,19H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 35 |
| By standard InChI | CHEMBL77686 |
|---|---|
| By standard InChI Main Layer | CHEMBL77686 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 18 |
| rosids | 7 |
| Liliopsida | 3 |
| eudicotyledons | 3 |
| Magnoliophyta | 2 |
| Euphyllophyta | 2 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Asteraceae | 11 |
| Lamiaceae | 3 |
| Zingiberaceae | 3 |
| Pteridaceae | 2 |
| Crassulaceae | 2 |
| Cunoniaceae | 2 |
| Nyctaginaceae | 1 |
| Plantaginaceae | 1 |
| Boraginaceae | 1 |
| Sapindaceae | 1 |