id | C00000603 |
---|---|
Name | (-)-Lariciresinol |
CAS RN | 83327-19-9 |
Standard InChI | InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3 |
Phytochemical cluster | No. 21 |
---|---|
KCF-S cluster | No. 700 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL518421 |
By LinkDB |
---|
By CAS RN | C060282 |
---|
class name | count |
---|---|
rosids | 5 |
Spermatophyta | 3 |
eudicotyledons | 1 |
asterids | 1 |
family name | count |
---|---|
Thymelaeaceae | 2 |
Fabaceae | 2 |
Asteraceae | 1 |
Araucariaceae | 1 |
Balanophoraceae | 1 |
Pinaceae | 1 |
Linaceae | 1 |
Cupressaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL518421 |
CHEMBL1669910
(1)
|
1 / 0 |
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL518421 |
CHEMBL1669909
(1)
|
0 / 1 |