| id | C00006934 |
|---|---|
| Name | Pinostrobin chalcone / 2',6'-Dihydroxy-4'-methoxychalcone |
| CAS RN | 18956-15-5 |
| Standard InChI | InChI=1S/C16H14O4/c1-20-12-9-14(18)16(15(19)10-12)13(17)8-7-11-5-3-2-4-6-11/h2-10,18-19H,1H3/b8-7+ |
| Standard InChI (Main Layer) | InChI=1S/C16H14O4/c1-20-12-9-14(18)16(15(19)10-12)13(17)8-7-11-5-3-2-4-6-11/h2-10,18-19H,1H3 |
| Phytochemical cluster | No. 13 |
|---|---|
| KCF-S cluster | No. 92 |
| By standard InChI | CHEMBL317221 |
|---|---|
| By standard InChI Main Layer | CHEMBL317221 CHEMBL1705800 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 3 |
| Euphyllophyta | 3 |
| Liliopsida | 2 |
| rosids | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Pteridaceae | 3 |
| Piperaceae | 2 |
| Zingiberaceae | 2 |
| Salicaceae | 1 |
| Asteraceae | 1 |
| Lauraceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL317221 |
CHEMBL1614027
(1)
|
0 / 1 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL317221 |
CHEMBL1613777
(1)
|
1 / 1 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL317221 |
CHEMBL1614211
(1)
|
0 / 0 |