| id | C00025319 |
|---|---|
| Name | Oxoxylopin / Oxoxylopine / Lanuginosine |
| CAS RN | 23740-25-2 |
| Standard InChI | InChI=1S/C18H11NO4/c1-21-10-2-3-11-12(7-10)17(20)16-14-9(4-5-19-16)6-13-18(15(11)14)23-8-22-13/h2-7H,8H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H11NO4/c1-21-10-2-3-11-12(7-10)17(20)16-14-9(4-5-19-16)6-13-18(15(11)14)23-8-22-13/h2-7H,8H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 74 |
| By standard InChI | CHEMBL389400 |
|---|---|
| By standard InChI Main Layer | CHEMBL389400 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 13 |
| eudicotyledons | 3 |
| family name | count |
|---|---|
| Annonaceae | 11 |
| Menispermaceae | 3 |
| Magnoliaceae | 2 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00734 | Prothrombin | S1A | CHEMBL389400 |
CHEMBL944432
(1)
|
4 / 2 |