| id | C00002770 |
|---|---|
| Name | Rosmarinic acid |
| CAS RN | 20283-92-5 |
| Standard InChI | InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25)/b6-3+/t16-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O8/c19-12-4-1-10(7-14(12)21)3-6-17(23)26-16(18(24)25)9-11-2-5-13(20)15(22)8-11/h1-8,16,19-22H,9H2,(H,24,25) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 749 |
| By standard InChI | CHEMBL324842 |
|---|---|
| By standard InChI Main Layer | CHEMBL66966 CHEMBL324842 CHEMBL1315100 CHEMBL2111558 |
| By LinkDB | C01850 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 27 |
| Liliopsida | 1 |
| rosids | 1 |
| family name | count |
|---|---|
| Lamiaceae | 20 |
| Apiaceae | 5 |
| Boraginaceae | 2 |
| Araceae | 1 |
| Malvaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL1315100 |
CHEMBL1741321
(1)
|
1 / 0 |
| Q07820 | Induced myeloid leukemia cell differentiation protein Mcl-1 | Other cytosolic protein | CHEMBL324842 |
CHEMBL1614529
(1)
|
0 / 0 |
| Q9UIF8 | Bromodomain adjacent to zinc finger domain protein 2B | Unclassified protein | CHEMBL66966 CHEMBL324842 |
CHEMBL1738312
(2)
|
0 / 0 |
| P14618 | Pyruvate kinase PKM | Enzyme | CHEMBL324842 |
CHEMBL1613996
(1)
CHEMBL1614428
(1)
|
0 / 0 |
| P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL324842 |
CHEMBL1008498
(1)
|
0 / 3 |
| Q13093 | Platelet-activating factor acetylhydrolase | Enzyme | CHEMBL324842 |
CHEMBL1032505
(1)
|
3 / 0 |
| P06746 | DNA polymerase beta | Enzyme | CHEMBL66966 CHEMBL324842 |
CHEMBL1614079
(2)
|
0 / 0 |
| P04062 | Glucosylceramidase | Enzyme | CHEMBL324842 |
CHEMBL1613818
(1)
|
6 / 4 |
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL66966 CHEMBL324842 |
CHEMBL1614076
(2)
|
1 / 1 |
| O75604 | Ubiquitin carboxyl-terminal hydrolase 2 | Enzyme | CHEMBL324842 |
CHEMBL1614474
(1)
|
0 / 0 |
| P10828 | Thyroid hormone receptor beta | NR1A2 | CHEMBL324842 |
CHEMBL1614554
(1)
CHEMBL1613776
(1)
|
3 / 1 |
| P06241 | Tyrosine-protein kinase Fyn | Src | CHEMBL324842 |
CHEMBL919495
(1)
CHEMBL919496
(1)
CHEMBL919497 (1) CHEMBL919498 (1) CHEMBL919499 (1) CHEMBL919500 (1) CHEMBL919501 (1) CHEMBL919502 (1) |
0 / 0 |
| P11712 | Cytochrome P450 2C9 | Cytochrome P450 2C9 | CHEMBL1315100 |
CHEMBL1741325
(1)
|
0 / 1 |
| P54132 | Bloom syndrome protein | Enzyme | CHEMBL324842 |
CHEMBL1614067
(1)
|
1 / 2 |
| Q9NR56 | Muscleblind-like protein 1 | Unclassified protein | CHEMBL66966 |
CHEMBL1614166
(1)
|
1 / 0 |
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL324842 |
CHEMBL1008497
(1)
|
0 / 0 |
| P39748 | Flap endonuclease 1 | Enzyme | CHEMBL66966 |
CHEMBL1794486
(1)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL66966 |
CHEMBL1738606
(2)
|
0 / 0 |
| P15121 | Aldose reductase | Enzyme | CHEMBL324842 |
CHEMBL1103716
(1)
|
0 / 0 |
| P40763 | Signal transducer and activator of transcription 3 | Transcription Factor | CHEMBL324842 |
CHEMBL1029438
(1)
|
1 / 2 |
| P03956 | Interstitial collagenase | M10A | CHEMBL324842 |
CHEMBL2342140
(1)
CHEMBL2342141
(1)
|
0 / 1 |
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL66966 |
CHEMBL1794569
(1)
|
1 / 1 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL66966 |
CHEMBL1794401
(1)
|
0 / 0 |
| O94782 | Ubiquitin carboxyl-terminal hydrolase 1 | Enzyme | CHEMBL1315100 |
CHEMBL1794467
(1)
|
0 / 0 |
| P12931 | Proto-oncogene tyrosine-protein kinase Src | Src | CHEMBL324842 |
CHEMBL1024395
(1)
|
0 / 0 |
| P05177 | Cytochrome P450 1A2 | Cytochrome P450 1A2 | CHEMBL1315100 |
CHEMBL1741322
(1)
|
0 / 0 |
| Q99714 | 3-hydroxyacyl-CoA dehydrogenase type-2 | Enzyme | CHEMBL66966 CHEMBL1315100 |
CHEMBL1613910
(2)
CHEMBL1614227
(1)
|
3 / 3 |
| P51692 | Signal transducer and activator of transcription 5B | Unclassified protein | CHEMBL324842 |
CHEMBL1029439
(1)
|
1 / 1 |
| P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD(+)] | Enzyme | CHEMBL66966 CHEMBL1315100 |
CHEMBL1614038
(2)
|
2 / 2 |
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL324842 |
CHEMBL1738588
(1)
|
0 / 0 |
| P33261 | Cytochrome P450 2C19 | Cytochrome P450 2C19 | CHEMBL1315100 |
CHEMBL1741323
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL1315100 |
CHEMBL1741324
(1)
|
0 / 1 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL66966 |
CHEMBL1794483
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL66966 |
CHEMBL1737991
(1)
|
0 / 0 |
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL66966 CHEMBL324842 CHEMBL1315100 |
CHEMBL1614466
(1)
CHEMBL1614211
(4)
|
0 / 0 |
| P10636 | Microtubule-associated protein tau | Unclassified protein | CHEMBL66966 CHEMBL324842 CHEMBL1315100 |
CHEMBL1614250
(1)
CHEMBL1614421
(3)
CHEMBL1614502 (2) |
4 / 3 |
| P06239 | Tyrosine-protein kinase Lck | Src | CHEMBL324842 |
CHEMBL841495
(1)
CHEMBL1024394
(1)
|
0 / 1 |
| Q12794 | Hyaluronidase-1 | Enzyme | CHEMBL324842 |
CHEMBL1111859
(1)
|
1 / 2 |
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL66966 CHEMBL1315100 |
CHEMBL1794536
(4)
|
0 / 0 |
| B2RXH2 | Lysine-specific demethylase 4E | Enzyme | CHEMBL66966 CHEMBL324842 CHEMBL1315100 |
CHEMBL1613914
(4)
|
0 / 0 |
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL66966 CHEMBL324842 |
CHEMBL1613829
(2)
|
0 / 0 |
| P42224 | Signal transducer and activator of transcription 1-alpha/beta | Unclassified protein | CHEMBL324842 |
CHEMBL1024398
(1)
|
3 / 3 |
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL66966 |
CHEMBL1738442
(1)
|
0 / 0 |
| Q9NUW8 | Tyrosyl-DNA phosphodiesterase 1 | Enzyme | CHEMBL66966 CHEMBL324842 CHEMBL1315100 |
CHEMBL1614364
(4)
|
1 / 1 |
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL66966 |
CHEMBL1613933
(1)
|
0 / 1 |
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL66966 |
CHEMBL1613933
(1)
|
1 / 6 |
| O94925 | Glutaminase kidney isoform, mitochondrial | Enzyme | CHEMBL66966 |
CHEMBL2114738
(1)
|
0 / 0 |
| Q9H0H5 | Rac GTPase-activating protein 1 | Unclassified protein | CHEMBL66966 |
CHEMBL2114881
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #300438 | 17-beta-hydroxysteroid dehydrogenase x deficiency |
Q99714
|
| #600807 | Asthma, susceptibility to |
Q13093
|
| #209950 | Atypical mycobacteriosis, familial |
P42224
|
| #210900 | Bloom syndrome; blm |
P54132
|
| #614162 | Candidiasis, familial, 7; candf7 |
P42224
|
| #119900 | Digital clubbing, isolated congenital |
P15428
|
| #609535 | Drug metabolism, poor, cyp2c19-related |
P33261
|
| #608902 | Drug metabolism, poor, cyp2d6-related |
P10635
|
| #600274 | Frontotemporal dementia; ftd |
P10636
|
| #608013 | Gaucher disease, perinatal lethal |
P04062
|
| #230800 | Gaucher disease, type i |
P04062
|
| #230900 | Gaucher disease, type ii |
P04062
|
| #231000 | Gaucher disease, type iii |
P04062
|
| #231005 | Gaucher disease, type iiic |
P04062
|
| #232300 | Glycogen storage disease ii |
P10253
|
| #245590 | Growth hormone insensitivity with immunodeficiency |
P51692
|
| #147060 | Hyper-ige recurrent infection syndrome, autosomal dominant |
P40763
|
| #259100 | Hypertrophic osteoarthropathy, primary, autosomal recessive, 1; phoar1 |
P15428
|
| #147050 | Ige responsiveness, atopic; iger |
Q13093
|
| #300705 | Mental retardation, x-linked 17; mrx17 |
Q99714
|
| #300220 | Mental retardation, x-linked, syndromic 10; mrxs10 |
Q99714
|
| #601492 | Mucopolysaccharidosis, type ix; mps9 |
Q12794
|
| #613796 | Mycobacterial and viral infections, susceptibility to, autosomal recessive |
P42224
|
| #160900 | Myotonic dystrophy 1; dm1 |
Q9NR56
|
| #168600 | Parkinson disease, late-onset; pd |
P04062
|
| #260540 | Parkinson-dementia syndrome |
P10636
|
| #172700 | Pick disease of brain |
P10636
|
| #601399 | Platelet disorder, familial, with associated myeloid malignancy |
Q01196
|
| #614278 | Platelet-activating factor acetylhydrolase deficiency; pafad |
Q13093
|
| #607250 | Spinocerebellar ataxia, autosomal recessive, with axonal neuropathy; scan1 |
Q9NUW8
|
| #601104 | Supranuclear palsy, progressive, 1; psnp1 |
P10636
|
| #188570 | Thyroid hormone resistance, generalized, autosomal dominant; grth |
P10828
|
| #274300 | Thyroid hormone resistance, generalized, autosomal recessive; grth |
P10828
|
| #145650 | Thyroid hormone resistance, selective pituitary; prth |
P10828
|
| #278750 | Xeroderma pigmentosum, variant type; xpv |
Q9Y253
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00028 | Choriocarcinoma |
P03956
(related)
|
| H00066 | Lewy body dementia (LBD) |
P04062
(related)
|
| H00126 | Gaucher disease |
P04062
(related)
|
| H00426 | Defects in the degradation of ganglioside |
P04062
(related)
|
| H00810 | Progressive myoclonic epilepsy (PME) |
P04062
(related)
|
| H00093 | Combined immunodeficiencies (CIDs) |
P06239
(related)
|
| H00036 | Osteosarcoma |
P08684
(marker)
|
| H00069 | Glycogen storage diseases (GSD) |
P10253
(related)
|
| H00058 | Amyotrophic lateral sclerosis (ALS) |
P10636
(related)
|
| H00077 | Progressive supranuclear palsy (PSP) |
P10636
(related)
|
| H00078 | Frontotemporal lobar degeneration (FTLD) |
P10636
(related)
|
| H00249 | Thyroid hormone resistance syndrome |
P10828
(related)
|
| H01205 | Coumarin resistance |
P11712
(related)
|
| H00457 | Primary hypertrophic osteoarthropathy (PHO) |
P15428
(related)
|
| H01246 | Isolated congenital nail clubbing (ICNC) |
P15428
(related)
|
| H01171 | Poor drug metabolism (PM) |
P33261
(related)
|
| H00017 | Esophageal cancer |
P35354
(related)
|
| H00025 | Penile cancer |
P35354
(related)
|
| H00046 | Cholangiocarcinoma |
P35354
(related)
|
| H00016 | Oral cancer |
P40763
(related)
|
| H00107 | Other well-defined immunodeficiency syndromes |
P40763
(related)
|
| H00089 | IFN-gamma/IL-12 axis |
P42224
(related)
|
| H00363 | Candidiasis |
P42224
(related)
|
| H01109 | Chronic mucocutaneous candidiasis (CMC) |
P42224
(related)
|
| H00931 | Growth hormone insensitivity with immunodeficiency |
P51692
(related)
|
| H00094 | DNA repair defects |
P54132
(related)
|
| H00296 | Defects in RecQ helicases |
P54132
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q01196
(related)
Q01196 (marker) |
| H00003 | Acute myeloid leukemia (AML) |
Q01196
(related)
Q01196 (marker) Q13951 (marker) |
| H00004 | Chronic myeloid leukemia (CML) |
Q01196
(related)
|
| H00978 | Thrombocytopenia (THC) |
Q01196
(related)
|
| H00133 | Mucopolysaccharidosis type IX (MPS9) |
Q12794
(related)
|
| H00421 | Mucopolysaccharidosis (MPS) |
Q12794
(related)
|
| H00480 | Non-syndromic X-linked mental retardation |
Q99714
(related)
|
| H00658 | Syndromic X-linked mental retardation |
Q99714
(related)
|
| H00925 | 2-Methyl-3-hydroxybutyryl-CoA dehydrogenase (MHBD) deficiency |
Q99714
(related)
|
| H00063 | Spinocerebellar ataxia (SCA) |
Q9NUW8
(related)
|
| H00403 | Disorders of nucleotide excision repair |
Q9Y253
(related)
|