id | C00031274 |
---|---|
Name | Salidroside / Rhodioloside / (-)-Rhodioloside / Tyrosol alpha-(beta-D-glucopyranoside) |
CAS RN | 10338-51-9 |
Standard InChI | InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2/t10-,11-,12+,13-,14-/m1/s1 |
Standard InChI (Main Layer) | InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2 |
Phytochemical cluster | No. 72 |
---|---|
KCF-S cluster | No. 45 |
By standard InChI | CHEMBL465208 |
---|---|
By standard InChI Main Layer | CHEMBL465208 CHEMBL1899113 |
By LinkDB | C06046 |
---|
By CAS RN | C009172 |
---|
class name | count |
---|---|
asterids | 12 |
eudicotyledons | 3 |
rosids | 1 |
Magnoliophyta | 1 |
family name | count |
---|---|
Lamiaceae | 4 |
Plantaginaceae | 4 |
Crassulaceae | 3 |
Hypericaceae | 1 |
Hydrangeaceae | 1 |
Piperaceae | 1 |
Bignoniaceae | 1 |
Oleaceae | 1 |
Acanthaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL465208 |
CHEMBL1008496
(1)
|
0 / 0 |
O75496 | Geminin | Unclassified protein | CHEMBL1899113 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1899113 |
CHEMBL1794401
(1)
|
0 / 0 |