| id | C00031274 |
|---|---|
| Name | Salidroside / Rhodioloside / (-)-Rhodioloside / Tyrosol alpha-(beta-D-glucopyranoside) |
| CAS RN | 10338-51-9 |
| Standard InChI | InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2/t10-,11-,12+,13-,14-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2 |
| Phytochemical cluster | No. 72 |
|---|---|
| KCF-S cluster | No. 45 |
| By standard InChI | CHEMBL465208 |
|---|---|
| By standard InChI Main Layer | CHEMBL465208 CHEMBL1899113 |
| By LinkDB | C06046 |
|---|
| By CAS RN | C009172 |
|---|
| class name | count |
|---|---|
| asterids | 12 |
| eudicotyledons | 3 |
| rosids | 1 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Lamiaceae | 4 |
| Plantaginaceae | 4 |
| Crassulaceae | 3 |
| Hypericaceae | 1 |
| Hydrangeaceae | 1 |
| Piperaceae | 1 |
| Bignoniaceae | 1 |
| Oleaceae | 1 |
| Acanthaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL465208 |
CHEMBL1008496
(1)
|
0 / 0 |
| O75496 | Geminin | Unclassified protein | CHEMBL1899113 |
CHEMBL2114843
(1)
CHEMBL2114780
(1)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1899113 |
CHEMBL1794401
(1)
|
0 / 0 |