id | C00004638 |
---|---|
Name | Quercetin 3,7-dimethyl ether / 5,3',4'-Trihydroxy-3,7-dimethoxyflavone / 2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,7-dimethoxy-4H-1-benzopyran-4-one |
CAS RN | 2068-02-2 |
Standard InChI | InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C17H14O7/c1-22-9-6-12(20)14-13(7-9)24-16(17(23-2)15(14)21)8-3-4-10(18)11(19)5-8/h3-7,18-20H,1-2H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 3 |
By standard InChI | CHEMBL164861 |
---|---|
By standard InChI Main Layer | CHEMBL164861 |
By LinkDB | C01265 |
---|
By CAS RN | C065497 |
---|
class name | count |
---|---|
asterids | 22 |
rosids | 7 |
eudicotyledons | 4 |
Liliopsida | 1 |
family name | count |
---|---|
Asteraceae | 13 |
Solanaceae | 3 |
Boraginaceae | 2 |
Viscaceae | 2 |
Cunoniaceae | 2 |
Geraniaceae | 2 |
Euphorbiaceae | 1 |
Phrymaceae | 1 |
Zygophyllaceae | 1 |
Calceolariaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9NPH5 | NADPH oxidase 4 | Enzyme | CHEMBL164861 |
CHEMBL1249157
(1)
CHEMBL1249158
(1)
CHEMBL1249160 (1) |
0 / 0 |
P00747 | Plasminogen | S1A | CHEMBL164861 |
CHEMBL979307
(1)
|
1 / 2 |