| id | C00007204 |
|---|---|
| Name | Isolariciresinol / (+)-Isolariciresinol |
| CAS RN | 548-29-8 |
| Standard InChI | InChI=1S/C20H24O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-4,6-8,13,15,20-24H,5,9-10H2,1-2H3/t13-,15-,20-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-4,6-8,13,15,20-24H,5,9-10H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 406 |
| By standard InChI | CHEMBL399512 |
|---|---|
| By standard InChI Main Layer | CHEMBL399512 CHEMBL1760593 |
| By LinkDB |
|---|
| By CAS RN | C060284 |
|---|
| class name | count |
|---|---|
| Spermatophyta | 17 |
| asterids | 12 |
| rosids | 9 |
| eudicotyledons | 4 |
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Pinaceae | 8 |
| Taxaceae | 5 |
| Acanthaceae | 4 |
| Rubiaceae | 3 |
| Thymelaeaceae | 2 |
| Cupressaceae | 2 |
| Verbenaceae | 1 |
| Menispermaceae | 1 |
| Ericaceae | 1 |
| Resedaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL399512 |
CHEMBL1669910
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL399512 |
CHEMBL1669909
(1)
|
0 / 1 |