id | C00007204 |
---|---|
Name | Isolariciresinol / (+)-Isolariciresinol |
CAS RN | 548-29-8 |
Standard InChI | InChI=1S/C20H24O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-4,6-8,13,15,20-24H,5,9-10H2,1-2H3/t13-,15-,20-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H24O6/c1-25-18-6-11(3-4-16(18)23)20-14-8-17(24)19(26-2)7-12(14)5-13(9-21)15(20)10-22/h3-4,6-8,13,15,20-24H,5,9-10H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 406 |
By standard InChI | CHEMBL399512 |
---|---|
By standard InChI Main Layer | CHEMBL399512 CHEMBL1760593 |
By LinkDB |
---|
By CAS RN | C060284 |
---|
class name | count |
---|---|
Spermatophyta | 17 |
asterids | 12 |
rosids | 9 |
eudicotyledons | 4 |
Magnoliophyta | 1 |
family name | count |
---|---|
Pinaceae | 8 |
Taxaceae | 5 |
Acanthaceae | 4 |
Rubiaceae | 3 |
Thymelaeaceae | 2 |
Cupressaceae | 2 |
Verbenaceae | 1 |
Menispermaceae | 1 |
Ericaceae | 1 |
Resedaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL399512 |
CHEMBL1669910
(1)
|
1 / 0 |
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL399512 |
CHEMBL1669909
(1)
|
0 / 1 |