| id | C00002227 |
|---|---|
| Name | Matrine / (+)-Matrine |
| CAS RN | 519-02-8 |
| Standard InChI | InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2 |
| Phytochemical cluster | No. 3 |
|---|---|
| KCF-S cluster | No. 85 |
| By standard InChI | CHEMBL204860 |
|---|---|
| By standard InChI Main Layer | CHEMBL204860 CHEMBL383443 CHEMBL525227 CHEMBL1396816 CHEMBL1733145 CHEMBL1824581 |
| By LinkDB | C10774 |
|---|
| By CAS RN | C034244 |
|---|
| class name | count |
|---|---|
| rosids | 13 |
| eudicotyledons | 2 |
| family name | count |
|---|---|
| Fabaceae | 13 |
| Daphniphyllaceae | 1 |
| Berberidaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL1824581 |
CHEMBL1826307
(1)
|
0 / 0 |
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL1733145 |
CHEMBL1738606
(1)
|
0 / 0 |
| P28482 | Mitogen-activated protein kinase 1 | Erk | CHEMBL1396816 |
CHEMBL1613808
(1)
|
0 / 0 |
| O00255 | Menin | Unclassified protein | CHEMBL1396816 |
CHEMBL1614531
(1)
|
2 / 5 |
| Q03164 | Histone-lysine N-methyltransferase 2A | Enzyme | CHEMBL1396816 |
CHEMBL1614531
(1)
|
1 / 3 |
| compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
|---|---|---|---|---|---|---|---|
| C034244 | 4609 |
MYC
MRTL MYCC bHLHe39 c-Myc |
v-myc avian myelocytomatosis viral oncogene homolog | matrine results in decreased expression of MYC mRNA |
decreases expression
|
mRNA |
11489473
|
| C034244 | 4893 |
NRAS
ALPS4 N-ras NRAS1 NS6 |
neuroblastoma RAS viral (v-ras) oncogene homolog | matrine results in increased expression of NRAS mRNA |
increases expression
|
mRNA |
11489473
|
| C034244 | 7150 |
TOP1
TOPI |
topoisomerase (DNA) I (EC:5.99.1.2) | matrine analog results in decreased activity of TOP1 protein |
decreases activity
|
protein |
21194615
|
| C034244 | 7157 |
TP53
BCC7 LFS1 P53 TRP53 |
tumor protein p53 | matrine results in increased expression of TP53 mRNA |
increases expression
|
mRNA |
11489473
|
| OMIM | preferred title | UniProt |
|---|---|---|
| #605130 | Hairy elbows, short stature, facial dysmorphism, and developmental delay |
Q03164
|
| #145000 | Hyperparathyroidism 1; hrpt1 |
O00255
|
| #131100 | Multiple endocrine neoplasia, type i; men1 |
O00255
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00033 | Adrenal carcinoma |
O00255
(related)
|
| H00034 | Carcinoid |
O00255
(related)
|
| H00045 | Malignant islet cell carcinoma |
O00255
(related)
|
| H00246 | Primary hyperparathyroidism |
O00255
(related)
|
| H01102 | Pituitary adenomas |
O00255
(related)
|
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) |
Q03164
(related)
Q03164 (marker) |
| H00002 | Acute lymphoblastic leukemia (ALL) (precursor T lymphoblastic leukemia) |
Q03164
(related)
|
| MeSH disease | OMIM | compound | disease name | evidence type |
reference
pmid |
|---|---|---|---|---|---|
| D002289 | C034244 | Carcinoma, Non-Small-Cell Lung |
therapeutic
|
21312072
|
|
| D002779 | C034244 | Cholestasis |
therapeutic
|
19619254
|
|
| D056487 | C034244 | Drug-Induced Liver Injury, Chronic |
therapeutic
|
19426721
|
|
| D006331 | C034244 | Heart Diseases |
therapeutic
|
20604842
|
|
| D008113 | C034244 | Liver Neoplasms |
therapeutic
|
19426721
|