id | C00002728 |
---|---|
Name | Coniferaldehyde / Coniferyl aldehyde / 4-Hydroxy-3-methoxycinnamaldehyde |
CAS RN | 458-36-6 |
Standard InChI | InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3/b3-2+ |
Standard InChI (Main Layer) | InChI=1S/C10H10O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-7,12H,1H3 |
Phytochemical cluster | No. 6 |
---|---|
KCF-S cluster | No. 310 |
By standard InChI | CHEMBL242529 |
---|---|
By standard InChI Main Layer | CHEMBL242529 CHEMBL1956165 |
By LinkDB | C02666 |
---|
By CAS RN | C075384 |
---|
class name | count |
---|---|
rosids | 11 |
asterids | 3 |
Spermatophyta | 2 |
Magnoliophyta | 1 |
Liliopsida | 1 |
eudicotyledons | 1 |
family name | count |
---|---|
Fabaceae | 2 |
Poaceae | 1 |
Rubiaceae | 1 |
Asteraceae | 1 |
Myrtaceae | 1 |
Gesneriaceae | 1 |
Moraceae | 1 |
Thymelaeaceae | 1 |
Magnoliaceae | 1 |
Celastraceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P47989 | Xanthine dehydrogenase/oxidase | Oxidoreductase | CHEMBL242529 |
CHEMBL1058545
(1)
CHEMBL2051343
(1)
CHEMBL2051344 (1) |
1 / 1 |