| id | C00007636 |
|---|---|
| Name | delta-Cadinene |
| CAS RN | |
| Standard InChI | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13,15H,5-8H2,1-4H3/t13-,15-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13,15H,5-8H2,1-4H3 |
| Phytochemical cluster | No. 39 |
|---|---|
| KCF-S cluster | No. 1524 |
| By standard InChI | CHEMBL445759 |
|---|---|
| By standard InChI Main Layer | CHEMBL445759 |
| By LinkDB | C06394 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 9 |
| Spermatophyta | 7 |
| Magnoliophyta | 6 |
| asterids | 6 |
| Liliopsida | 3 |
| Embryophyta | 2 |
| family name | count |
|---|---|
| Pinaceae | 6 |
| Piperaceae | 3 |
| Asteraceae | 3 |
| Fabaceae | 2 |
| Cyperaceae | 2 |
| Cistaceae | 2 |
| Annonaceae | 2 |
| Lamiaceae | 1 |
| Apiaceae | 1 |
| Fagaceae | 1 |