id | C00002591 |
---|---|
Name | (-)-Cubebin / beta-Cubebin / (-)-beta-Cubebin / (8R,8'R,9S)-Cubebin |
CAS RN | 18423-69-3 |
Standard InChI | InChI=1S/C20H20O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15,20-21H,5-6,9-11H2/t14-,15+,20-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H20O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15,20-21H,5-6,9-11H2 |
Phytochemical cluster | No. 21 |
---|---|
KCF-S cluster | No. 629 |
By standard InChI | CHEMBL399831 |
---|---|
By standard InChI Main Layer | CHEMBL182001 CHEMBL399831 |
By LinkDB | C10549 |
---|
By CAS RN | C433065 |
---|
class name | count |
---|---|
Spermatophyta | 13 |
asterids | 11 |
rosids | 8 |
Magnoliophyta | 5 |
eudicotyledons | 3 |
family name | count |
---|---|
Pinaceae | 7 |
Acanthaceae | 4 |
Aristolochiaceae | 3 |
Taxaceae | 3 |
Cupressaceae | 2 |
Rubiaceae | 2 |
Betulaceae | 1 |
Ulmaceae | 1 |
Urticaceae | 1 |
Thymelaeaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL399831 |
CHEMBL970954
(1)
|
1 / 0 |
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL399831 |
CHEMBL970953
(1)
|
0 / 1 |