| id | C00002374 |
|---|---|
| Name | Chrysanthemin / Cyanidin 3-O-glucoside |
| CAS RN | 7084-24-4 |
| Standard InChI | InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p+1/t16?,17-,18?,19?,21-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26) |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 2 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL257839 CHEMBL1197952 |
| By LinkDB | C08604 |
|---|
| By CAS RN | C114438 |
|---|
| class name | count |
|---|---|
| rosids | 36 |
| Liliopsida | 29 |
| asterids | 18 |
| eudicotyledons | 6 |
| Spermatophyta | 5 |
| family name | count |
|---|---|
| Fabaceae | 23 |
| Poaceae | 20 |
| Pinaceae | 5 |
| Amaryllidaceae | 4 |
| Asteraceae | 4 |
| Rosaceae | 3 |
| Crassulaceae | 3 |
| Phrymaceae | 2 |
| Lardizabalaceae | 2 |
| Passifloraceae | 2 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P28907 | ADP-ribosyl cyclase 1 | Enzyme | CHEMBL257839 |
CHEMBL1285540
(1)
CHEMBL1799589
(1)
|
0 / 1 |