| id | C00025252 |
|---|---|
| Name | Rotundine / l-Tetrahydropalmatine / (-)-Tetrahydropalmatine / (-)-Rotundine(Stephania) |
| CAS RN | 483-14-7 |
| Standard InChI | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H25NO4/c1-23-18-6-5-13-9-17-15-11-20(25-3)19(24-2)10-14(15)7-8-22(17)12-16(13)21(18)26-4/h5-6,10-11,17H,7-9,12H2,1-4H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 37 |
| By standard InChI | CHEMBL487182 |
|---|---|
| By standard InChI Main Layer | CHEMBL187892 CHEMBL487182 CHEMBL2334889 |
| By LinkDB | C02890 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 24 |
| family name | count |
|---|---|
| Menispermaceae | 23 |
| Papaveraceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P21728 | D(1A) dopamine receptor | Dopamine receptor | CHEMBL487182 CHEMBL2334889 |
CHEMBL2343280
(2)
CHEMBL2343284
(2)
|
0 / 0 |
| P14416 | D(2) dopamine receptor | Dopamine receptor | CHEMBL487182 CHEMBL2334889 |
CHEMBL2343279
(2)
CHEMBL2343283
(2)
|
2 / 0 |
| Q99720 | Sigma non-opioid intracellular receptor 1 | Membrane receptor | CHEMBL187892 |
CHEMBL839610
(1)
|
1 / 0 |
| P13726 | Tissue factor | Membrane receptor | CHEMBL187892 CHEMBL487182 |
CHEMBL2319887
(2)
|
0 / 0 |
| P03372 | Estrogen receptor | NR3A1 | CHEMBL487182 |
CHEMBL1941568
(1)
CHEMBL1941569
(1)
|
1 / 1 |
| P28223 | 5-hydroxytryptamine receptor 2A | Serotonin receptor | CHEMBL487182 CHEMBL2334889 |
CHEMBL2343277
(2)
CHEMBL2343281
(2)
|
0 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL187892 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |
| P08908 | 5-hydroxytryptamine receptor 1A | Serotonin receptor | CHEMBL487182 CHEMBL2334889 |
CHEMBL2343278
(2)
CHEMBL2343282
(2)
|
1 / 0 |