id | C00002608 |
---|---|
Name | Hinokinin / Hinoquinin / (-)-Hinokinin / (-)-Hinoquinin |
CAS RN | 26543-89-5 |
Standard InChI | InChI=1S/C20H18O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15H,5-6,9-11H2/t14-,15+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H18O6/c21-20-15(6-13-2-4-17-19(8-13)26-11-24-17)14(9-22-20)5-12-1-3-16-18(7-12)25-10-23-16/h1-4,7-8,14-15H,5-6,9-11H2 |
Phytochemical cluster | No. 21 |
---|---|
KCF-S cluster | No. 629 |
By standard InChI | CHEMBL242011 |
---|---|
By standard InChI Main Layer | CHEMBL180970 CHEMBL182073 CHEMBL242011 |
By LinkDB | C10627 |
---|
By CAS RN | C475934 |
---|
class name | count |
---|---|
Magnoliophyta | 16 |
Spermatophyta | 9 |
rosids | 6 |
asterids | 5 |
family name | count |
---|---|
Cupressaceae | 9 |
Aristolochiaceae | 6 |
Piperaceae | 5 |
Myristicaceae | 3 |
Rutaceae | 3 |
Phyllanthaceae | 2 |
Lamiaceae | 1 |
Schisandraceae | 1 |
Lauraceae | 1 |
Acanthaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL242011 |
CHEMBL970954
(1)
|
1 / 0 |
P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL242011 |
CHEMBL970953
(1)
CHEMBL1743432
(2)
|
0 / 1 |