| id | C00002546 |
|---|---|
| Name | Inermin / Maackiain / (-)-Maackiain / Demethylpterocarpin / 3-Hydroxy-8,9-methylenedioxypterocarpan |
| CAS RN | 2035-15-6 |
| Standard InChI | InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2/t11-,16-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 66 |
| By standard InChI | CHEMBL334918 |
|---|---|
| By standard InChI Main Layer | CHEMBL334918 CHEMBL239047 CHEMBL445279 |
| By LinkDB | C10502 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 137 |
| asterids | 1 |
| Spermatophyta | 1 |
| family name | count |
|---|---|
| Fabaceae | 137 |
| Asteraceae | 1 |
| Pinaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P13866 | Sodium/glucose cotransporter 1 | Glucose | CHEMBL334918 |
CHEMBL892510
(1)
|
1 / 1 |
| P31639 | Sodium/glucose cotransporter 2 | Glucose | CHEMBL334918 |
CHEMBL892511
(1)
|
1 / 1 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL239047 |
CHEMBL1614108
(1)
CHEMBL1613886
(1)
|
0 / 1 |