id | C00025655 |
---|---|
Name | Corytuberine / (+)-Corytuberine |
CAS RN | 517-56-6 |
Standard InChI | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(24-3)19(22)17-15(11)12(20)8-10-4-5-13(23-2)18(21)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3/t12-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C19H21NO4/c1-20-7-6-11-9-14(24-3)19(22)17-15(11)12(20)8-10-4-5-13(23-2)18(21)16(10)17/h4-5,9,12,21-22H,6-8H2,1-3H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 20 |
By standard InChI | CHEMBL227965 |
---|---|
By standard InChI Main Layer | CHEMBL227965 |
By LinkDB | C17591 |
---|
By CAS RN | C013896 |
---|
class name | count |
---|---|
eudicotyledons | 22 |
Magnoliophyta | 11 |
family name | count |
---|---|
Papaveraceae | 15 |
Menispermaceae | 6 |
Annonaceae | 5 |
Lauraceae | 5 |
Ranunculaceae | 1 |
Hernandiaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL227965 |
CHEMBL1067148
(1)
|
0 / 0 |