id | C00025827 |
---|---|
Name | Corydine / Glaucentrin / (+)-Corydine / Glaucentrine |
CAS RN | 476-69-7 |
Standard InChI | InChI=1S/C20H23NO4/c1-21-8-7-12-10-15(24-3)19(22)18-16(12)13(21)9-11-5-6-14(23-2)20(25-4)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3/t13-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C20H23NO4/c1-21-8-7-12-10-15(24-3)19(22)18-16(12)13(21)9-11-5-6-14(23-2)20(25-4)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3 |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 20 |
By standard InChI | CHEMBL489524 |
---|---|
By standard InChI Main Layer | CHEMBL489524 CHEMBL2002847 |
By LinkDB |
---|
By CAS RN | C067341 |
---|
class name | count |
---|---|
eudicotyledons | 19 |
Magnoliophyta | 4 |
rosids | 1 |
family name | count |
---|---|
Menispermaceae | 11 |
Papaveraceae | 7 |
Lauraceae | 2 |
Annonaceae | 2 |
Euphorbiaceae | 1 |
Berberidaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P24941 | Cyclin-dependent kinase 2 | Cdc2 | CHEMBL489524 |
CHEMBL1067148
(1)
|
0 / 0 |