id | C00000100 |
---|---|
Name | IAA / Indole-3-acetic acid |
CAS RN | 87-51-4 |
Standard InChI | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13) |
Standard InChI (Main Layer) | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13) |
Phytochemical cluster | No. 4 |
---|---|
KCF-S cluster | No. 1432 |
By standard InChI | CHEMBL82411 |
---|---|
By standard InChI Main Layer | CHEMBL82411 |
By LinkDB | C00954 |
---|
By CAS RN | C030737 |
---|
class name | count |
---|---|
rosids | 24 |
Spermatophyta | 6 |
asterids | 4 |
Liliopsida | 1 |
Euphyllophyta | 1 |
family name | count |
---|---|
Fabaceae | 9 |
Pinaceae | 5 |
Brassicaceae | 3 |
Rosaceae | 3 |
Fagaceae | 2 |
Rutaceae | 2 |
Solanaceae | 2 |
Euphorbiaceae | 2 |
Hominidae | 2 |
Rhizopodaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q16773 | Kynurenine--oxoglutarate transaminase 1 | Enzyme | CHEMBL82411 |
CHEMBL1002982
(1)
|
0 / 0 |
P02768 | Serum albumin | Secreted protein | CHEMBL82411 |
CHEMBL894775
(1)
|
0 / 0 |
Q9HBH1 | Peptide deformylase, mitochondrial | Enzyme | CHEMBL82411 |
CHEMBL912248
(1)
|
0 / 0 |
compound | gene | gene name | gene description | interaction | interaction type | form |
reference
pmid |
---|---|---|---|---|---|---|---|
C030737 | 196 |
AHR
bHLHe76 |
aryl hydrocarbon receptor | indoleacetic acid results in increased activity of [AHR protein binds to ARNT protein] |
affects binding
/ increases activity |
protein |
9407059
|
C030737 | 405 |
ARNT
HIF-1-beta HIF-1beta HIF1-beta HIF1B HIF1BETA TANGO bHLHe2 |
aryl hydrocarbon receptor nuclear translocator | indoleacetic acid results in increased activity of [AHR protein binds to ARNT protein] |
affects binding
/ increases activity |
protein |
9407059
|