| id | C00000602 |
|---|---|
| Name | (+)-Lariciresinol |
| CAS RN | 27003-73-2 |
| Standard InChI | InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3/t14-,15-,20+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H24O6/c1-24-18-8-12(3-5-16(18)22)7-14-11-26-20(15(14)10-21)13-4-6-17(23)19(9-13)25-2/h3-6,8-9,14-15,20-23H,7,10-11H2,1-2H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 700 |
| By standard InChI | CHEMBL518421 |
|---|---|
| By standard InChI Main Layer | CHEMBL518421 |
| By LinkDB | C10646 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 23 |
| rosids | 15 |
| Spermatophyta | 11 |
| Magnoliophyta | 3 |
| eudicotyledons | 3 |
| Euphyllophyta | 1 |
| Liliopsida | 1 |
| family name | count |
|---|---|
| Thymelaeaceae | 10 |
| Pinaceae | 7 |
| Lamiaceae | 5 |
| Oleaceae | 4 |
| Taxaceae | 3 |
| Magnoliaceae | 3 |
| Acanthaceae | 3 |
| Ranunculaceae | 2 |
| Fabaceae | 2 |
| Rubiaceae | 2 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL518421 |
CHEMBL1669910
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL518421 |
CHEMBL1669909
(1)
|
0 / 1 |