| id | C00000091 |
|---|---|
| Name | trans-Zeatin |
| CAS RN | 1637-39-4 |
| Standard InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+ |
| Standard InChI (Main Layer) | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2879 |
| By standard InChI | CHEMBL525239 |
|---|---|
| By standard InChI Main Layer | CHEMBL525239 |
| By LinkDB | C00371 |
|---|
| By CAS RN | D015026 |
|---|
| class name | count |
|---|---|
| rosids | 20 |
| asterids | 10 |
| Liliopsida | 5 |
| Spermatophyta | 1 |
| Embryophyta | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Fabaceae | 7 |
| Poaceae | 4 |
| Asteraceae | 3 |
| Solanaceae | 3 |
| Brassicaceae | 3 |
| Apocynaceae | 2 |
| Rhizopogonaceae | 2 |
| Euphorbiaceae | 2 |
| Rosaceae | 2 |
| Fagaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL525239 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL525239 |
CHEMBL1613829
(1)
|
0 / 0 |