id | C00000853 |
---|---|
Name | Myrcene |
CAS RN | 123-35-3 |
Standard InChI | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3 |
Standard InChI (Main Layer) | InChI=1S/C10H16/c1-5-10(4)8-6-7-9(2)3/h5,7H,1,4,6,8H2,2-3H3 |
Phytochemical cluster | No. 34 |
---|---|
KCF-S cluster | No. 2285 |
By standard InChI | CHEMBL455491 |
---|---|
By standard InChI Main Layer | CHEMBL455491 |
By LinkDB | C06074 |
---|
By CAS RN | C008574 |
---|
class name | count |
---|---|
rosids | 18 |
asterids | 17 |
Spermatophyta | 8 |
Magnoliophyta | 7 |
Liliopsida | 3 |
eudicotyledons | 1 |
Embryophyta | 1 |
family name | count |
---|---|
Rutaceae | 10 |
Pinaceae | 7 |
Solanaceae | 4 |
Asteraceae | 4 |
Lamiaceae | 4 |
Myrtaceae | 3 |
Saururaceae | 3 |
Brassicaceae | 2 |
Zingiberaceae | 2 |
Cistaceae | 2 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P16473 | Thyrotropin receptor | Glycohormone receptor | CHEMBL455491 |
CHEMBL1614281
(1)
CHEMBL1614361
(1)
|
3 / 2 |
P04150 | Glucocorticoid receptor | NR3C1 | CHEMBL455491 |
CHEMBL1794456
(1)
|
0 / 1 |
Q96RI1 | Bile acid receptor | NR1H4 | CHEMBL455491 |
CHEMBL1794415
(1)
|
0 / 0 |