id | C00002657 |
---|---|
Name | p-Formylphenol / 4-Hydroxybenzaldehyde / p-Hydroxybenzaldehyde |
CAS RN | 123-08-0 |
Standard InChI | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
Standard InChI (Main Layer) | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 2076 |
By standard InChI | CHEMBL14193 |
---|---|
By standard InChI Main Layer | CHEMBL14193 |
By LinkDB | C00633 |
---|
By CAS RN | C011483 |
---|
class name | count |
---|---|
rosids | 14 |
Liliopsida | 10 |
asterids | 6 |
eudicotyledons | 5 |
Magnoliophyta | 3 |
Spermatophyta | 2 |
Viridiplantae | 1 |
Embryophyta | 1 |
Euphyllophyta | 1 |
family name | count |
---|---|
Rutaceae | 4 |
Zingiberaceae | 3 |
Lauraceae | 3 |
Euphorbiaceae | 2 |
Orchidaceae | 2 |
Caryophyllaceae | 2 |
Poaceae | 2 |
Fabaceae | 2 |
Asteraceae | 2 |
Cupressaceae | 2 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P51649 | Succinate-semialdehyde dehydrogenase, mitochondrial | Oxidoreductase | CHEMBL14193 |
CHEMBL867028
(1)
|
1 / 1 |
P14902 | Indoleamine 2,3-dioxygenase 1 | Enzyme | CHEMBL14193 |
CHEMBL2092115
(1)
|
0 / 0 |
P80404 | 4-aminobutyrate aminotransferase, mitochondrial | Transferase | CHEMBL14193 |
CHEMBL867027
(1)
CHEMBL986116
(1)
|
1 / 1 |