| id | C00002657 |
|---|---|
| Name | p-Formylphenol / 4-Hydroxybenzaldehyde / p-Hydroxybenzaldehyde |
| CAS RN | 123-08-0 |
| Standard InChI | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
| Standard InChI (Main Layer) | InChI=1S/C7H6O2/c8-5-6-1-3-7(9)4-2-6/h1-5,9H |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2076 |
| By standard InChI | CHEMBL14193 |
|---|---|
| By standard InChI Main Layer | CHEMBL14193 |
| By LinkDB | C00633 |
|---|
| By CAS RN | C011483 |
|---|
| class name | count |
|---|---|
| rosids | 14 |
| Liliopsida | 10 |
| asterids | 6 |
| eudicotyledons | 5 |
| Magnoliophyta | 3 |
| Spermatophyta | 2 |
| Viridiplantae | 1 |
| Embryophyta | 1 |
| Euphyllophyta | 1 |
| family name | count |
|---|---|
| Rutaceae | 4 |
| Zingiberaceae | 3 |
| Lauraceae | 3 |
| Euphorbiaceae | 2 |
| Orchidaceae | 2 |
| Caryophyllaceae | 2 |
| Poaceae | 2 |
| Fabaceae | 2 |
| Asteraceae | 2 |
| Cupressaceae | 2 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P51649 | Succinate-semialdehyde dehydrogenase, mitochondrial | Oxidoreductase | CHEMBL14193 |
CHEMBL867028
(1)
|
1 / 1 |
| P14902 | Indoleamine 2,3-dioxygenase 1 | Enzyme | CHEMBL14193 |
CHEMBL2092115
(1)
|
0 / 0 |
| P80404 | 4-aminobutyrate aminotransferase, mitochondrial | Transferase | CHEMBL14193 |
CHEMBL867027
(1)
CHEMBL986116
(1)
|
1 / 1 |