| id | C00002631 |
|---|---|
| Name | (+)-Lirioresinol B / (+)-Syringaresinol |
| CAS RN | 21453-69-0 |
| Standard InChI | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3/t13-,14-,21+,22+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C22H26O8/c1-25-15-5-11(6-16(26-2)19(15)23)21-13-9-30-22(14(13)10-29-21)12-7-17(27-3)20(24)18(8-12)28-4/h5-8,13-14,21-24H,9-10H2,1-4H3 |
| Phytochemical cluster | No. 21 |
|---|---|
| KCF-S cluster | No. 38 |
| By standard InChI | CHEMBL361362 |
|---|---|
| By standard InChI Main Layer | CHEMBL361362 CHEMBL402653 |
| By LinkDB | C10889 |
|---|
| By CAS RN | C042192 |
|---|
| class name | count |
|---|---|
| asterids | 73 |
| rosids | 47 |
| Magnoliophyta | 26 |
| eudicotyledons | 13 |
| Liliopsida | 12 |
| Spermatophyta | 3 |
| Embryophyta | 1 |
| family name | count |
|---|---|
| Araliaceae | 14 |
| Rutaceae | 13 |
| Magnoliaceae | 10 |
| Asteraceae | 10 |
| Thymelaeaceae | 9 |
| Apocynaceae | 9 |
| Lauraceae | 9 |
| Annonaceae | 7 |
| Orobanchaceae | 7 |
| Lamiaceae | 7 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL361362 |
CHEMBL832445
(1)
CHEMBL832449
(1)
CHEMBL832452 (1) |
0 / 0 |